C19H28N2O5 — CID 136720858
2-[[(10Z)-10-hydroxyimino-10-(2-hydroxy-5-methylphenyl)decanoyl]amino]acetic acid (PubChem CID 136720858) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[[(10Z)-10-hydroxyimino-10-(2-hydroxy-5-methylphenyl)decanoyl]amino]acetic acid.
| Compound Name | 2-[[(10Z)-10-hydroxyimino-10-(2-hydroxy-5-methylphenyl)decanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 136720858 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[[(10Z)-10-hydroxyimino-10-(2-hydroxy-5-methylphenyl)decanoyl]amino]acetic acid |
| SMILES | Cc1ccc(O)c(/C(CCCCCCCCC(=O)NCC(=O)O)=N\O)c1 |
| InChI | InChI=1S/C19H28N2O5/c1-14-10-11-17(22)15(12-14)16(21-26)8-6-4-2-3-5-7-9-18(23)20-13-19(24)25/h10-12,22,26H,2-9,13H2,1H3,(H,20,23)(H,24,25)/b21-16- |
| InChIKey | FLWYGPZJEAWAET-PGMHBOJBSA-N |
| XLogP | 3.20 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|