C13H17NO4 — CID 4293573
6-hydroxyimino-6-(2-hydroxy-4-methylphenyl)hexanoic acid (PubChem CID 4293573) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 6-hydroxyimino-6-(2-hydroxy-4-methylphenyl)hexanoic acid.
| Compound Name | 6-hydroxyimino-6-(2-hydroxy-4-methylphenyl)hexanoic acid |
|---|---|
| PubChem CID | 4293573 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 6-hydroxyimino-6-(2-hydroxy-4-methylphenyl)hexanoic acid |
| SMILES | Cc1ccc(C(CCCCC(=O)O)=NO)c(O)c1 |
| InChI | InChI=1S/C13H17NO4/c1-9-6-7-10(12(15)8-9)11(14-18)4-2-3-5-13(16)17/h6-8,15,18H,2-5H2,1H3,(H,16,17) |
| InChIKey | DIRWLUKUWUENFE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|