C38H46N4O2 — CID 136886923
2-[(Z)-N-anilino-C-[(11Z)-11-(2-hydroxy-4-methylphenyl)-11-(phenylhydrazinylidene)undecyl]carbonimidoyl]-5-methylphenol (PubChem CID 136886923) has the molecular formula C38H46N4O2 and a molecular weight of 590.81 g/mol. Its IUPAC name is 2-[(Z)-N-anilino-C-[(11Z)-11-(2-hydroxy-4-methylphenyl)-11-(phenylhydrazinylidene)undecyl]carbonimidoyl]-5-methylphenol.
| Compound Name | 2-[(Z)-N-anilino-C-[(11Z)-11-(2-hydroxy-4-methylphenyl)-11-(phenylhydrazinylidene)undecyl]carbonimidoyl]-5-methylphenol |
|---|---|
| PubChem CID | 136886923 |
| Molecular Formula | C38H46N4O2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | 2-[(Z)-N-anilino-C-[(11Z)-11-(2-hydroxy-4-methylphenyl)-11-(phenylhydrazinylidene)undecyl]carbonimidoyl]-5-methylphenol |
| SMILES | Cc1ccc(/C(CCCCCCCCCC/C(=N/Nc2ccccc2)c2ccc(C)cc2O)=N\Nc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C38H46N4O2/c1-29-23-25-33(37(43)27-29)35(41-39-31-17-11-9-12-18-31)21-15-7-5-3-4-6-8-16-22-36(34-26-24-30(2)28-38(34)44)42-40-32-19-13-10-14-20-32/h9-14,17-20,23-28,39-40,43-44H,3-8,15-16,21-22H2,1-2H3/b41-35-,42-36- |
| InChIKey | WOABQOMWOREXEG-CSMBQKPMSA-N |
| XLogP | 9.95 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|