C10H14N4O4 — CID 136723287
ethyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]acetate (PubChem CID 136723287) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is ethyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]acetate.
| Compound Name | ethyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 136723287 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | ethyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H14N4O4/c1-3-18-8(16)5-11-10(17)14-9-12-6(2)4-7(15)13-9/h4H,3,5H2,1-2H3,(H3,11,12,13,14,15,17) |
| InChIKey | SBMJBABNKVWMPY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |