C8H8F3N3O3 — CID 136741316
methyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate (PubChem CID 136741316) has the molecular formula C8H8F3N3O3 and a molecular weight of 251.16 g/mol. Its IUPAC name is methyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate.
| Compound Name | methyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 136741316 |
| Molecular Formula | C8H8F3N3O3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | methyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate |
| SMILES | COC(=O)CNc1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H8F3N3O3/c1-17-6(16)3-12-7-13-4(8(9,10)11)2-5(15)14-7/h2H,3H2,1H3,(H2,12,13,14,15) |
| InChIKey | XXLIWSSODDMEFZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |