C9H10F3N3O3 — CID 136741382
ethyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate (PubChem CID 136741382) has the molecular formula C9H10F3N3O3 and a molecular weight of 265.19 g/mol. Its IUPAC name is ethyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 136741382 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | ethyl 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H10F3N3O3/c1-2-18-7(17)4-13-8-14-5(9(10,11)12)3-6(16)15-8/h3H,2,4H2,1H3,(H2,13,14,15,16) |
| InChIKey | HCDBQUYADRLVLX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |