C23H27N5O — CID 136723843
1-[4-(diethylamino)phenyl]-4-(5,6-dimethyl-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136723843) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-4-(5,6-dimethyl-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-[4-(diethylamino)phenyl]-4-(5,6-dimethyl-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136723843 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-4-(5,6-dimethyl-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3cc(C)c(C)cc3[nH]2)=C(O)CN1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H27N5O/c1-5-27(6-2)16-7-9-17(10-8-16)28-13-20(29)21(22(28)24)23-25-18-11-14(3)15(4)12-19(18)26-23/h7-12,24,29H,5-6,13H2,1-4H3,(H,25,26)/b24-22- |
| InChIKey | BYAAVQVACNYLNF-GYHWCHFESA-N |
| XLogP | 4.79 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|