C20H20N4O — CID 135773875
1-(3,4-dimethylphenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 135773875) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(3,4-dimethylphenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135773875 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(C)cc3[nH]2)=C(O)CN1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H20N4O/c1-11-4-7-15-16(8-11)23-20(22-15)18-17(25)10-24(19(18)21)14-6-5-12(2)13(3)9-14/h4-9,21,25H,10H2,1-3H3,(H,22,23)/b21-19- |
| InChIKey | YPQGBMSKRWTKOT-VZCXRCSSSA-N |
| XLogP | 4.25 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|