C18H14Cl2N4O — CID 135773876
1-(3,5-dichlorophenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 135773876) has the molecular formula C18H14Cl2N4O and a molecular weight of 373.24 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(3,5-dichlorophenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135773876 |
| Molecular Formula | C18H14Cl2N4O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(C)cc3[nH]2)=C(O)CN1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N4O/c1-9-2-3-13-14(4-9)23-18(22-13)16-15(25)8-24(17(16)21)12-6-10(19)5-11(20)7-12/h2-7,21,25H,8H2,1H3,(H,22,23)/b21-17- |
| InChIKey | FFBINUPAQSJDDK-FXBPSFAMSA-N |
| XLogP | 4.94 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|