C18H23N5O2 — CID 135690949
5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-3-ol (PubChem CID 135690949) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135690949 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(C)cc3[nH]2)=C(O)CN1CCN1CCOCC1 |
| InChI | InChI=1S/C18H23N5O2/c1-12-2-3-13-14(10-12)21-18(20-13)16-15(24)11-23(17(16)19)5-4-22-6-8-25-9-7-22/h2-3,10,19,24H,4-9,11H2,1H3,(H,20,21)/b19-17- |
| InChIKey | CGVNVGDRLYILNZ-ZPHPHTNESA-N |
| XLogP | 1.77 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|