C19H15F3N4O — CID 136724080
5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol (PubChem CID 136724080) has the molecular formula C19H15F3N4O and a molecular weight of 372.35 g/mol. Its IUPAC name is 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724080 |
| Molecular Formula | C19H15F3N4O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-imino-4-(6-methyl-1H-benzimidazol-2-yl)-1-[4-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(C)cc3[nH]2)=C(O)CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N4O/c1-10-2-7-13-14(8-10)25-18(24-13)16-15(27)9-26(17(16)23)12-5-3-11(4-6-12)19(20,21)22/h2-8,23,27H,9H2,1H3,(H,24,25)/b23-17- |
| InChIKey | FZNHPRNCDZOKLG-QJOMJCCJSA-N |
| XLogP | 4.66 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|