C23H18FN5O — CID 136724623
1-(4-anilinophenyl)-4-(6-fluoro-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136724623) has the molecular formula C23H18FN5O and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-4-(6-fluoro-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-(4-anilinophenyl)-4-(6-fluoro-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724623 |
| Molecular Formula | C23H18FN5O |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-(4-anilinophenyl)-4-(6-fluoro-1H-benzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(F)cc3[nH]2)=C(O)CN1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18FN5O/c24-14-6-11-18-19(12-14)28-23(27-18)21-20(30)13-29(22(21)25)17-9-7-16(8-10-17)26-15-4-2-1-3-5-15/h1-12,25-26,30H,13H2,(H,27,28)/b25-22- |
| InChIKey | ZKQABUAVKNTLFR-LVWGJNHUSA-N |
| XLogP | 5.21 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|