C25H24N4OS — CID 136725434
4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-1-[2-(1H-indol-3-yl)ethyl]-2H-pyrrol-3-ol (PubChem CID 136725434) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-1-[2-(1H-indol-3-yl)ethyl]-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-1-[2-(1H-indol-3-yl)ethyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725434 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5-imino-1-[2-(1H-indol-3-yl)ethyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C)c(C)c3)cs2)=C(O)CN1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H24N4OS/c1-15-7-8-17(11-16(15)2)21-14-31-25(28-21)23-22(30)13-29(24(23)26)10-9-18-12-27-20-6-4-3-5-19(18)20/h3-8,11-12,14,26-27,30H,9-10,13H2,1-2H3/b26-24- |
| InChIKey | VRZMMRYWQUGZPK-LCUIJRPUSA-N |
| XLogP | 5.71 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|