C20H32N4O3S — CID 136727250
3-(cyclopentylsulfamoyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperidine-1-carboximidamide (PubChem CID 136727250) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperidine-1-carboximidamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 136727250 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperidine-1-carboximidamide |
| SMILES | C=CCN/C(=N\CCc1ccco1)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C20H32N4O3S/c1-2-12-21-20(22-13-11-18-9-6-15-27-18)24-14-5-10-19(16-24)28(25,26)23-17-7-3-4-8-17/h2,6,9,15,17,19,23H,1,3-5,7-8,10-14,16H2,(H,21,22) |
| InChIKey | YJQPNWRMBGABNP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|