C19H25IN4O3 — CID 136920644
4-(furan-2-carbonyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 136920644) has the molecular formula C19H25IN4O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 136920644 |
| Molecular Formula | C19H25IN4O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-[2-(furan-2-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\CCc1ccco1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C19H24N4O3.HI/c1-2-8-20-19(21-9-7-16-5-3-14-25-16)23-12-10-22(11-13-23)18(24)17-6-4-15-26-17;/h2-6,14-15H,1,7-13H2,(H,20,21);1H |
| InChIKey | MOWRZOANDQDUJS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|