C19H14F2N2O3S — CID 136732050
2-[(2,5-difluorophenyl)diazenyl]-3-(4-methylphenyl)sulfinylbenzene-1,4-diol (PubChem CID 136732050) has the molecular formula C19H14F2N2O3S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)diazenyl]-3-(4-methylphenyl)sulfinylbenzene-1,4-diol.
| Compound Name | 2-[(2,5-difluorophenyl)diazenyl]-3-(4-methylphenyl)sulfinylbenzene-1,4-diol |
|---|---|
| PubChem CID | 136732050 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[(2,5-difluorophenyl)diazenyl]-3-(4-methylphenyl)sulfinylbenzene-1,4-diol |
| SMILES | Cc1ccc(S(=O)c2c(O)ccc(O)c2/N=N/c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C19H14F2N2O3S/c1-11-2-5-13(6-3-11)27(26)19-17(25)9-8-16(24)18(19)23-22-15-10-12(20)4-7-14(15)21/h2-10,24-25H,1H3/b23-22+ |
| InChIKey | XKCIJHZQJKDBJQ-GHVJWSGMSA-N |
| XLogP | 5.27 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|