C10H14N4O — CID 136736688
5-amino-4-(hex-5-ynylamino)-1H-pyrimidin-6-one (PubChem CID 136736688) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-amino-4-(hex-5-ynylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(hex-5-ynylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136736688 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-amino-4-(hex-5-ynylamino)-1H-pyrimidin-6-one |
| SMILES | C#CCCCCNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C10H14N4O/c1-2-3-4-5-6-12-9-8(11)10(15)14-7-13-9/h1,7H,3-6,11H2,(H2,12,13,14,15) |
| InChIKey | RQZVEOLJRKOAAM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|