C21H19F3N6O2S — CID 136737094
4-(furan-2-ylmethyl)-3-[(5R,7R)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 136737094) has the molecular formula C21H19F3N6O2S and a molecular weight of 476.48 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)-3-[(5R,7R)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(furan-2-ylmethyl)-3-[(5R,7R)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136737094 |
| Molecular Formula | C21H19F3N6O2S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-(furan-2-ylmethyl)-3-[(5R,7R)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc([C@H]2C[C@H](C(F)(F)F)n3ncc(-c4n[nH]c(=S)n4Cc4ccco4)c3N2)cc1 |
| InChI | InChI=1S/C21H19F3N6O2S/c1-31-13-6-4-12(5-7-13)16-9-17(21(22,23)24)30-18(26-16)15(10-25-30)19-27-28-20(33)29(19)11-14-3-2-8-32-14/h2-8,10,16-17,26H,9,11H2,1H3,(H,28,33)/t16-,17-/m1/s1 |
| InChIKey | YSFKJAYUDPYZLA-IAGOWNOFSA-N |
| XLogP | 5.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_urea_H(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|