C18H19F3N6OS — CID 136737061
4-(2-ethoxyphenyl)-3-[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 136737061) has the molecular formula C18H19F3N6OS and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-3-[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-ethoxyphenyl)-3-[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136737061 |
| Molecular Formula | C18H19F3N6OS |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-(2-ethoxyphenyl)-3-[(5S,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccccc1-n1c(-c2cnn3c2N[C@@H](C)C[C@@H]3C(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C18H19F3N6OS/c1-3-28-13-7-5-4-6-12(13)26-16(24-25-17(26)29)11-9-22-27-14(18(19,20)21)8-10(2)23-15(11)27/h4-7,9-10,14,23H,3,8H2,1-2H3,(H,25,29)/t10-,14+/m0/s1 |
| InChIKey | AIPMQFCRNYOGPC-IINYFYTJSA-N |
| XLogP | 4.50 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|