C8H8BrClF3N3O — CID 136737833
5-bromo-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136737833) has the molecular formula C8H8BrClF3N3O and a molecular weight of 334.52 g/mol. Its IUPAC name is 5-bromo-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136737833 |
| Molecular Formula | C8H8BrClF3N3O |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 5-bromo-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(CCCl)CC(F)(F)F)c1Br |
| InChI | InChI=1S/C8H8BrClF3N3O/c9-5-6(14-4-15-7(5)17)16(2-1-10)3-8(11,12)13/h4H,1-3H2,(H,14,15,17) |
| InChIKey | VYINUDTUXFRHOC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|