C8H9BrClF2N3O — CID 136737820
4-[2-bromoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136737820) has the molecular formula C8H9BrClF2N3O and a molecular weight of 316.53 g/mol. Its IUPAC name is 4-[2-bromoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[2-bromoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136737820 |
| Molecular Formula | C8H9BrClF2N3O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 4-[2-bromoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(CCBr)CC(F)F)c1Cl |
| InChI | InChI=1S/C8H9BrClF2N3O/c9-1-2-15(3-5(11)12)7-6(10)8(16)14-4-13-7/h4-5H,1-3H2,(H,13,14,16) |
| InChIKey | ROZIHIIGDYEETI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|