C8H8Cl2F3N3O — CID 136737831
5-chloro-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136737831) has the molecular formula C8H8Cl2F3N3O and a molecular weight of 290.07 g/mol. Its IUPAC name is 5-chloro-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136737831 |
| Molecular Formula | C8H8Cl2F3N3O |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-chloro-4-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(CCCl)CC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H8Cl2F3N3O/c9-1-2-16(3-8(11,12)13)6-5(10)7(17)15-4-14-6/h4H,1-3H2,(H,14,15,17) |
| InChIKey | GWWWNUKWVGDJNT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|