C18H16Br2N4O2 — CID 136739135
(2R)-3-(benzimidazol-1-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylpropanamide (PubChem CID 136739135) has the molecular formula C18H16Br2N4O2 and a molecular weight of 480.16 g/mol. Its IUPAC name is (2R)-3-(benzimidazol-1-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylpropanamide.
| Compound Name | (2R)-3-(benzimidazol-1-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 136739135 |
| Molecular Formula | C18H16Br2N4O2 |
| Molecular Weight | 480.16 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | (2R)-3-(benzimidazol-1-yl)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylpropanamide |
| SMILES | C[C@H](Cn1cnc2ccccc21)C(=O)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C18H16Br2N4O2/c1-11(9-24-10-21-15-4-2-3-5-16(15)24)18(26)23-22-8-12-6-13(19)7-14(20)17(12)25/h2-8,10-11,25H,9H2,1H3,(H,23,26)/b22-8-/t11-/m1/s1 |
| InChIKey | DACZQMVLDVTJLF-RAUJGMTKSA-N |
| XLogP | 4.05 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|