C27H17N5O2 — CID 136740066
9-ethoxy-2,5,17,23,26-pentazaheptacyclo[16.12.0.03,16.04,13.06,11.019,24.025,30]triaconta-1(30),2,4,6(11),7,9,13,15,18,20,22,24,26,28-tetradecaen-12-one (PubChem CID 136740066) has the molecular formula C27H17N5O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 9-ethoxy-2,5,17,23,26-pentazaheptacyclo[16.12.0.03,16.04,13.06,11.019,24.025,30]triaconta-1(30),2,4,6(11),7,9,13,15,18,20,22,24,26,28-tetradecaen-12-one.
| Compound Name | 9-ethoxy-2,5,17,23,26-pentazaheptacyclo[16.12.0.03,16.04,13.06,11.019,24.025,30]triaconta-1(30),2,4,6(11),7,9,13,15,18,20,22,24,26,28-tetradecaen-12-one |
|---|---|
| PubChem CID | 136740066 |
| Molecular Formula | C27H17N5O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 9-ethoxy-2,5,17,23,26-pentazaheptacyclo[16.12.0.03,16.04,13.06,11.019,24.025,30]triaconta-1(30),2,4,6(11),7,9,13,15,18,20,22,24,26,28-tetradecaen-12-one |
| SMILES | CCOc1ccc2nc3c(ccc4[nH]c5c6cccnc6c6ncccc6c5nc43)c(=O)c2c1 |
| InChI | InChI=1S/C27H17N5O2/c1-2-34-14-7-9-19-18(13-14)27(33)17-8-10-20-26(25(17)30-19)32-24-16-6-4-12-29-22(16)21-15(23(24)31-20)5-3-11-28-21/h3-13,31H,2H2,1H3 |
| InChIKey | HTEGSZFOBNDDGE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|