C24H17N5O2 — CID 86297884
2-(2,6-dimethoxyquinolin-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 86297884) has the molecular formula C24H17N5O2 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-(2,6-dimethoxyquinolin-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(2,6-dimethoxyquinolin-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 86297884 |
| Molecular Formula | C24H17N5O2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-(2,6-dimethoxyquinolin-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | COc1ccc2nc(OC)c(-c3nc4c5cccnc5c5ncccc5c4[nH]3)cc2c1 |
| InChI | InChI=1S/C24H17N5O2/c1-30-14-7-8-18-13(11-14)12-17(24(27-18)31-2)23-28-21-15-5-3-9-25-19(15)20-16(22(21)29-23)6-4-10-26-20/h3-12H,1-2H3,(H,28,29) |
| InChIKey | WPXVJPJMNXVXBC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|