C13H16N4O4S — CID 136742385
(4R)-3-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 136742385) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is (4R)-3-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 136742385 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (4R)-3-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | C[C@H](N)C(=O)N1CSC[C@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N4O4S/c1-8(14)13(19)16-7-22-6-11(16)12(18)15-9-2-4-10(5-3-9)17(20)21/h2-5,8,11H,6-7,14H2,1H3,(H,15,18)/t8-,11-/m0/s1 |
| InChIKey | OZAVUSPQXJWZQF-KWQFWETISA-N |
| XLogP | 0.78 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|