C13H12N4O3 — CID 136746545
N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136746545) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136746545 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cnc[nH]c1=O)c1ccccc1O |
| InChI | InChI=1S/C13H12N4O3/c1-8(9-4-2-3-5-11(9)18)16-17-13(20)10-6-14-7-15-12(10)19/h2-7,18H,1H3,(H,17,20)(H,14,15,19)/b16-8- |
| InChIKey | IRVHELIRCJPAJD-PXNMLYILSA-N |
| XLogP | 0.63 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|