C50H31N5O7 — CID 136748945
4-[10,20-bis(4-carboxyphenyl)-15-(8-hydroxyquinolin-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 136748945) has the molecular formula C50H31N5O7 and a molecular weight of 813.83 g/mol. Its IUPAC name is 4-[10,20-bis(4-carboxyphenyl)-15-(8-hydroxyquinolin-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,20-bis(4-carboxyphenyl)-15-(8-hydroxyquinolin-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 136748945 |
| Molecular Formula | C50H31N5O7 |
| Molecular Weight | 813.83 g/mol |
| Exact Mass | 813.22 |
| IUPAC Name | 4-[10,20-bis(4-carboxyphenyl)-15-(8-hydroxyquinolin-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccnc5c(O)cccc45)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C50H31N5O7/c56-42-3-1-2-33-32(24-25-51-47(33)42)46-40-22-20-38(54-40)44(27-6-12-30(13-7-27)49(59)60)36-18-16-34(52-36)43(26-4-10-29(11-5-26)48(57)58)35-17-19-37(53-35)45(39-21-23-41(46)55-39)28-8-14-31(15-9-28)50(61)62/h1-25,52,55-56H,(H,57,58)(H,59,60)(H,61,62)/b43-34-,43-35-,44-36-,44-38-,45-37-,45-39-,46-40-,46-41- |
| InChIKey | GTHGHXDKMHXDRV-KQWSROBNSA-N |
| XLogP | 10.67 |
| TPSA | 202.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.83 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |