C19H15N5O4S — CID 136755520
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine-2-carboxamide (PubChem CID 136755520) has the molecular formula C19H15N5O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine-2-carboxamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine-2-carboxamide |
|---|---|
| PubChem CID | 136755520 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nc2n(n1)-c1ccccc1S(=O)(=O)N2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H15N5O4S/c1-11(15-10-12-6-2-4-8-14(12)28-15)20-18(25)17-21-19-23-29(26,27)16-9-5-3-7-13(16)24(19)22-17/h2-11H,1H3,(H,20,25)(H,21,22,23)/t11-/m1/s1 |
| InChIKey | OBYLTHNDZWOEPP-LLVKDONJSA-N |
| XLogP | 2.62 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |