C17H27N3S — CID 136757017
N-[3-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propyl]-N-methylaniline (PubChem CID 136757017) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is N-[3-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propyl]-N-methylaniline.
| Compound Name | N-[3-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propyl]-N-methylaniline |
|---|---|
| PubChem CID | 136757017 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[3-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]propyl]-N-methylaniline |
| SMILES | CCC1(C)CCS/C(=N\CCCN(C)c2ccccc2)N1 |
| InChI | InChI=1S/C17H27N3S/c1-4-17(2)11-14-21-16(19-17)18-12-8-13-20(3)15-9-6-5-7-10-15/h5-7,9-10H,4,8,11-14H2,1-3H3,(H,18,19) |
| InChIKey | LERUNHYFJOYCQB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|