C13H26N2S — CID 136757189
4-ethyl-N-hexan-3-yl-4-methyl-1,3-thiazinan-2-imine (PubChem CID 136757189) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is 4-ethyl-N-hexan-3-yl-4-methyl-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-hexan-3-yl-4-methyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136757189 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4-ethyl-N-hexan-3-yl-4-methyl-1,3-thiazinan-2-imine |
| SMILES | CCCC(CC)/N=C1/NC(C)(CC)CCS1 |
| InChI | InChI=1S/C13H26N2S/c1-5-8-11(6-2)14-12-15-13(4,7-3)9-10-16-12/h11H,5-10H2,1-4H3,(H,14,15) |
| InChIKey | UCRCNSJWEPDVPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|