C15H29N3S — CID 136757242
N-[2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-methylcyclopentanamine (PubChem CID 136757242) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is N-[2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-methylcyclopentanamine.
| Compound Name | N-[2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-methylcyclopentanamine |
|---|---|
| PubChem CID | 136757242 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-[2-[(4-ethyl-4-methyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-methylcyclopentanamine |
| SMILES | CCC1(C)CCS/C(=N\CCN(C)C2CCCC2)N1 |
| InChI | InChI=1S/C15H29N3S/c1-4-15(2)9-12-19-14(17-15)16-10-11-18(3)13-7-5-6-8-13/h13H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | QHAHKPOFRIXRCI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|