C13H24N2S2 — CID 136757314
4-ethyl-4-methyl-N-(thian-2-ylmethyl)-1,3-thiazinan-2-imine (PubChem CID 136757314) has the molecular formula C13H24N2S2 and a molecular weight of 272.48 g/mol. Its IUPAC name is 4-ethyl-4-methyl-N-(thian-2-ylmethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-4-methyl-N-(thian-2-ylmethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136757314 |
| Molecular Formula | C13H24N2S2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-ethyl-4-methyl-N-(thian-2-ylmethyl)-1,3-thiazinan-2-imine |
| SMILES | CCC1(C)CCS/C(=N\CC2CCCCS2)N1 |
| InChI | InChI=1S/C13H24N2S2/c1-3-13(2)7-9-17-12(15-13)14-10-11-6-4-5-8-16-11/h11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | DJVCNEAAIMTYIJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|