C16H24N2S — CID 136757300
4-ethyl-4-methyl-N-[2-(2-methylphenyl)ethyl]-1,3-thiazinan-2-imine (PubChem CID 136757300) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-ethyl-4-methyl-N-[2-(2-methylphenyl)ethyl]-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-4-methyl-N-[2-(2-methylphenyl)ethyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136757300 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-ethyl-4-methyl-N-[2-(2-methylphenyl)ethyl]-1,3-thiazinan-2-imine |
| SMILES | CCC1(C)CCS/C(=N\CCc2ccccc2C)N1 |
| InChI | InChI=1S/C16H24N2S/c1-4-16(3)10-12-19-15(18-16)17-11-9-14-8-6-5-7-13(14)2/h5-8H,4,9-12H2,1-3H3,(H,17,18) |
| InChIKey | RWNAKLSBOPCPTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|