C15H25NO2S — CID 136757931
(5R)-5-[(2R)-2-ethylsulfanylpropyl]-2-(1-hydroxybutylidene)-3-iminocyclohexan-1-one (PubChem CID 136757931) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is (5R)-5-[(2R)-2-ethylsulfanylpropyl]-2-(1-hydroxybutylidene)-3-iminocyclohexan-1-one.
| Compound Name | (5R)-5-[(2R)-2-ethylsulfanylpropyl]-2-(1-hydroxybutylidene)-3-iminocyclohexan-1-one |
|---|---|
| PubChem CID | 136757931 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (5R)-5-[(2R)-2-ethylsulfanylpropyl]-2-(1-hydroxybutylidene)-3-iminocyclohexan-1-one |
| SMILES | [H]/N=C1\C[C@@H](C[C@@H](C)SCC)CC(=O)C1=C(O)CCC |
| InChI | InChI=1S/C15H25NO2S/c1-4-6-13(17)15-12(16)8-11(9-14(15)18)7-10(3)19-5-2/h10-11,16-17H,4-9H2,1-3H3/b15-13?,16-12+/t10-,11-/m1/s1 |
| InChIKey | ZRJCWIIQSOOKEW-GYGCWWRNSA-N |
| XLogP | 4.13 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|