C20H33NO2S — CID 1381350
(5S)-2-butanoyl-5-[(2R)-2-ethylsulfanylpropyl]-3-piperidin-1-ylcyclohex-2-en-1-one (PubChem CID 1381350) has the molecular formula C20H33NO2S and a molecular weight of 351.56 g/mol. Its IUPAC name is (5S)-2-butanoyl-5-[(2R)-2-ethylsulfanylpropyl]-3-piperidin-1-ylcyclohex-2-en-1-one.
| Compound Name | (5S)-2-butanoyl-5-[(2R)-2-ethylsulfanylpropyl]-3-piperidin-1-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 1381350 |
| Molecular Formula | C20H33NO2S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (5S)-2-butanoyl-5-[(2R)-2-ethylsulfanylpropyl]-3-piperidin-1-ylcyclohex-2-en-1-one |
| SMILES | CCCC(=O)C1=C(N2CCCCC2)C[C@H](C[C@@H](C)SCC)CC1=O |
| InChI | InChI=1S/C20H33NO2S/c1-4-9-18(22)20-17(21-10-7-6-8-11-21)13-16(14-19(20)23)12-15(3)24-5-2/h15-16H,4-14H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | QHILPRCSCDGDBR-CVEARBPZSA-N |
| XLogP | 4.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|