C11H12N4O3S — CID 136759638
N-[(Z)-1H-imidazol-2-ylmethylideneamino]-4-methoxybenzenesulfonamide (PubChem CID 136759638) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-[(Z)-1H-imidazol-2-ylmethylideneamino]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(Z)-1H-imidazol-2-ylmethylideneamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 136759638 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-[(Z)-1H-imidazol-2-ylmethylideneamino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C\c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-9-2-4-10(5-3-9)19(16,17)15-14-8-11-12-6-7-13-11/h2-8,15H,1H3,(H,12,13)/b14-8- |
| InChIKey | PQITUUWPJSODHT-ZSOIEALJSA-N |
| XLogP | 0.73 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|