C21H28F3N5O2 — CID 136761074
(5S,7R)-5-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136761074) has the molecular formula C21H28F3N5O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is (5S,7R)-5-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-5-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136761074 |
| Molecular Formula | C21H28F3N5O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (5S,7R)-5-[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOc1cc(CN2CCCC([C@@H]3C[C@H](C(F)(F)F)n4ncnc4N3)C2)ccc1OC |
| InChI | InChI=1S/C21H28F3N5O2/c1-3-31-18-9-14(6-7-17(18)30-2)11-28-8-4-5-15(12-28)16-10-19(21(22,23)24)29-20(27-16)25-13-26-29/h6-7,9,13,15-16,19H,3-5,8,10-12H2,1-2H3,(H,25,26,27)/t15?,16-,19+/m0/s1 |
| InChIKey | POJORGPZLBIGKC-UDGGGLCFSA-N |
| XLogP | 3.89 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |