C21H26F3N5O2 — CID 136673665
2-(4-ethoxyphenyl)-1-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone (PubChem CID 136673665) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenyl)-1-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 136673665 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCC([C@@H]3C[C@H](C(F)(F)F)n4ncnc4N3)CC2)cc1 |
| InChI | InChI=1S/C21H26F3N5O2/c1-2-31-16-5-3-14(4-6-16)11-19(30)28-9-7-15(8-10-28)17-12-18(21(22,23)24)29-20(27-17)25-13-26-29/h3-6,13,15,17-18H,2,7-12H2,1H3,(H,25,26,27)/t17-,18+/m0/s1 |
| InChIKey | DIVRCTRKIPFFNN-ZWKOTPCHSA-N |
| XLogP | 3.45 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |