C23H17F6N5O3 — CID 136764234
4-[(Z)-[[(5R,7R)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 136764234) has the molecular formula C23H17F6N5O3 and a molecular weight of 525.41 g/mol. Its IUPAC name is 4-[(Z)-[[(5R,7R)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[[(5R,7R)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 136764234 |
| Molecular Formula | C23H17F6N5O3 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 4-[(Z)-[[(5R,7R)-5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N\NC(=O)c2cc3n(n2)[C@@H](C(F)(F)C(F)(F)F)C[C@H](c2ccc(F)cc2)N3)cc1 |
| InChI | InChI=1S/C23H17F6N5O3/c24-15-7-5-13(6-8-15)16-9-18(22(25,26)23(27,28)29)34-19(31-16)10-17(33-34)20(35)32-30-11-12-1-3-14(4-2-12)21(36)37/h1-8,10-11,16,18,31H,9H2,(H,32,35)(H,36,37)/b30-11-/t16-,18-/m1/s1 |
| InChIKey | WXLKWAPCIRHLQK-AWRYSPIRSA-N |
| XLogP | 4.78 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|