C21H16F6N6O — CID 4771848
5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-N-(pyridin-4-ylmethylideneamino)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 4771848) has the molecular formula C21H16F6N6O and a molecular weight of 482.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-N-(pyridin-4-ylmethylideneamino)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-N-(pyridin-4-ylmethylideneamino)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 4771848 |
| Molecular Formula | C21H16F6N6O |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)-N-(pyridin-4-ylmethylideneamino)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NN=Cc1ccncc1)c1cc2n(n1)C(C(F)(F)C(F)(F)F)CC(c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C21H16F6N6O/c22-14-3-1-13(2-4-14)15-9-17(20(23,24)21(25,26)27)33-18(30-15)10-16(32-33)19(34)31-29-11-12-5-7-28-8-6-12/h1-8,10-11,15,17,30H,9H2,(H,31,34) |
| InChIKey | HZYKHPFSSQRAPV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|