C8H10ClN3O3 — CID 136766520
5-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 136766520) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is 5-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136766520 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 5-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CC(O)C(O)C2)c1Cl |
| InChI | InChI=1S/C8H10ClN3O3/c9-6-7(10-3-11-8(6)15)12-1-4(13)5(14)2-12/h3-5,13-14H,1-2H2,(H,10,11,15) |
| InChIKey | GCVFIVPNVKJCSW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |