C8H11N3O3 — CID 136766527
4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 136766527) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136766527 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-(3,4-dihydroxypyrrolidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CC(O)C(O)C2)nc[nH]1 |
| InChI | InChI=1S/C8H11N3O3/c12-5-2-11(3-6(5)13)7-1-8(14)10-4-9-7/h1,4-6,12-13H,2-3H2,(H,9,10,14) |
| InChIKey | YBLARNQONTXSOA-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |