C20H23N5O2 — CID 136774630
(4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-(2-methoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 136774630) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is (4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-(2-methoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | (4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-(2-methoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 136774630 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (4S)-4-[(1S)-cyclohex-3-en-1-yl]-2-(2-methoxyanilino)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccccc1NC1=N[C@H]([C@@H]2CC=CCC2)n2c(nc(C)cc2=O)N1 |
| InChI | InChI=1S/C20H23N5O2/c1-13-12-17(26)25-18(14-8-4-3-5-9-14)23-19(24-20(25)21-13)22-15-10-6-7-11-16(15)27-2/h3-4,6-7,10-12,14,18H,5,8-9H2,1-2H3,(H2,21,22,23,24)/t14-,18+/m1/s1 |
| InChIKey | XHOZLZUFCDMFET-KDOFPFPSSA-N |
| XLogP | 3.31 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|