C24H30N6O2 — CID 136823961
(4R)-4-[(1S)-cyclohex-3-en-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 136823961) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (4R)-4-[(1S)-cyclohex-3-en-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | (4R)-4-[(1S)-cyclohex-3-en-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 136823961 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (4R)-4-[(1S)-cyclohex-3-en-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | COc1ccc(N2CCN(C3=N[C@@H]([C@@H]4CC=CCC4)n4c(nc(C)cc4=O)N3)CC2)cc1 |
| InChI | InChI=1S/C24H30N6O2/c1-17-16-21(31)30-22(18-6-4-3-5-7-18)26-23(27-24(30)25-17)29-14-12-28(13-15-29)19-8-10-20(32-2)11-9-19/h3-4,8-11,16,18,22H,5-7,12-15H2,1-2H3,(H,25,26,27)/t18-,22-/m1/s1 |
| InChIKey | WDTRXVMVCRYSRY-XMSQKQJNSA-N |
| XLogP | 3.02 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|