C16H19N3O2S — CID 136776176
2-[[(2R)-oxolan-2-yl]methylamino]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136776176) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[[(2R)-oxolan-2-yl]methylamino]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[(2R)-oxolan-2-yl]methylamino]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136776176 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[[(2R)-oxolan-2-yl]methylamino]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(CSc2ccccc2)nc(NC[C@H]2CCCO2)[nH]1 |
| InChI | InChI=1S/C16H19N3O2S/c20-15-9-12(11-22-14-6-2-1-3-7-14)18-16(19-15)17-10-13-5-4-8-21-13/h1-3,6-7,9,13H,4-5,8,10-11H2,(H2,17,18,19,20)/t13-/m1/s1 |
| InChIKey | VPYPDALXDPWLNW-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |