C21H31N5O — CID 136779421
2-[4-[4-(2-methylpropyl)piperazin-1-yl]anilino]-4-propyl-1H-pyrimidin-6-one (PubChem CID 136779421) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[4-[4-(2-methylpropyl)piperazin-1-yl]anilino]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[4-[4-(2-methylpropyl)piperazin-1-yl]anilino]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136779421 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-[4-[4-(2-methylpropyl)piperazin-1-yl]anilino]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(Nc2ccc(N3CCN(CC(C)C)CC3)cc2)n1 |
| InChI | InChI=1S/C21H31N5O/c1-4-5-18-14-20(27)24-21(23-18)22-17-6-8-19(9-7-17)26-12-10-25(11-13-26)15-16(2)3/h6-9,14,16H,4-5,10-13,15H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | UQCCBVCINGPRCT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|