C20H26N4O3S — CID 135794476
(2R)-N-(4-morpholin-4-ylphenyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 135794476) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is (2R)-N-(4-morpholin-4-ylphenyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 135794476 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCCc1cc(=O)[nH]c(S[C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C20H26N4O3S/c1-3-4-16-13-18(25)23-20(22-16)28-14(2)19(26)21-15-5-7-17(8-6-15)24-9-11-27-12-10-24/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,21,26)(H,22,23,25)/t14-/m1/s1 |
| InChIKey | CHYOTGXUCXQQOI-CQSZACIVSA-N |
| XLogP | 2.68 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|