C19H21F3N4O2S — CID 136706613
2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 136706613) has the molecular formula C19H21F3N4O2S and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 136706613 |
| Molecular Formula | C19H21F3N4O2S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | CC(Sc1nc(C(F)(F)F)cc(=O)[nH]1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H21F3N4O2S/c1-12(29-18-24-15(19(20,21)22)11-16(27)25-18)17(28)23-13-5-7-14(8-6-13)26-9-3-2-4-10-26/h5-8,11-12H,2-4,9-10H2,1H3,(H,23,28)(H,24,25,27) |
| InChIKey | OBZMKXCMZOSEFH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|