C31H44N4O5 — CID 136780591
(3S)-1-(4-hexoxyphenyl)-3-[4-[2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]ethyl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 136780591) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is (3S)-1-(4-hexoxyphenyl)-3-[4-[2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]ethyl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-hexoxyphenyl)-3-[4-[2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]ethyl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 136780591 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (3S)-1-(4-hexoxyphenyl)-3-[4-[2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]ethyl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCOc1ccc(N2C(=O)C[C@H](N3CCN(CC/N=C/C4=C(O)CC(C)(C)CC4=O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C31H44N4O5/c1-4-5-6-7-18-40-24-10-8-23(9-11-24)35-29(38)19-26(30(35)39)34-16-14-33(15-17-34)13-12-32-22-25-27(36)20-31(2,3)21-28(25)37/h8-11,22,26,36H,4-7,12-21H2,1-3H3/b32-22+/t26-/m0/s1 |
| InChIKey | PGVHHZWOTRIJGE-CSWQPERPSA-N |
| XLogP | 4.17 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|